![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| album.nfo | 2024-03-12 22:10 | 4.0K | |
| Folder.jpg | 2025-08-18 12:51 | 45K | |
| AlbumArt_{B5020207-4..> | 2019-04-27 20:32 | 7.2K | |
| AlbumArt_{B5020207-4..> | 2019-04-27 20:32 | 41K | |
| AlbumArtSmall.jpg | 2025-08-18 12:51 | 7.9K | |
| 2-16 The Party's Ove..> | 2023-04-16 22:20 | 25M | |
| 2-15 Escape.flac | 2023-04-16 22:20 | 38M | |
| 2-14 Just the Same W..> | 2023-04-16 22:20 | 23M | |
| 2-13 Mother, Father...> | 2023-04-16 22:20 | 39M | |
| 2-12 Baby I'm a Leav..> | 2023-04-16 22:20 | 20M | |
| 2-11 Still They Ride..> | 2023-04-16 22:20 | 26M | |
| 2-10 Be Good to Your..> | 2023-04-16 22:20 | 29M | |
| 2-09 The Eyes of a W..> | 2023-04-16 22:20 | 30M | |
| 2-08 Good Morning Gi..> | 2023-04-16 22:20 | 10M | |
| 2-07 Patiently.flac | 2023-04-16 22:20 | 22M | |
| 2-06 Stone in Love.flac | 2023-04-16 22:20 | 29M | |
| 2-05 Anytime.flac | 2023-04-16 22:20 | 23M | |
| 2-04 Line of Fire.flac | 2023-04-16 22:20 | 24M | |
| 2-03 Somethin' to Hi..> | 2023-04-16 22:20 | 24M | |
| 2-02 Message of Love..> | 2023-04-16 22:20 | 44M | |
| 2-01 Chain Reaction...> | 2023-04-16 22:20 | 33M | |